Molecular Structure Identification (SMILES)
Try the first 5 questions
- 1.
The amino acid shown below is special because: ```smiles NCC(=O)O ```
- 2.
The nucleobase shown below pairs with which base in DNA? ```smiles c1nc(N)c2nc[nH]c2n1 ```
- 3.
How does the sugar below differ from glucose? ```smiles OC[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O ```
- 4.
This nucleobase replaces thymine in RNA. What is the structural difference between them? ```smiles O=c1cc[nH]c(=O)[nH]1 ```
- 5.
Identify the biomolecule shown below: ```smiles OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O ```
0 of 5 answered
This is a preview of 5 of 11 questions. The full quiz is available with a free account.
Sign up free to take the full quiz