Molecular Structure Identification (SMILES)

by Notetube Official11 questionsmedium9 views

Try the first 5 questions

  1. 1.

    The amino acid shown below is special because: ```smiles NCC(=O)O ```

  2. 2.

    The nucleobase shown below pairs with which base in DNA? ```smiles c1nc(N)c2nc[nH]c2n1 ```

  3. 3.

    How does the sugar below differ from glucose? ```smiles OC[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O ```

  4. 4.

    This nucleobase replaces thymine in RNA. What is the structural difference between them? ```smiles O=c1cc[nH]c(=O)[nH]1 ```

  5. 5.

    Identify the biomolecule shown below: ```smiles OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O ```

0 of 5 answered

This is a preview of 5 of 11 questions. The full quiz is available with a free account.

Sign up free to take the full quiz