Part of PC-06 — Equilibrium: Chemical & Ionic

Formula/Reaction Sheet — Equilibrium

by Notetube Official251 words8 views

Equilibrium Constants

Kc=[C]c[D]d[A]a[B]b(equilibrium concentrations only; omit pure solids and liquids)K_c = \frac{[C]^c[D]^d}{[A]^a[B]^b} \quad \text{(equilibrium concentrations only; omit pure solids and liquids)}

Kp=Kc(RT)Δnwhere Δn=moles gaseous productsmoles gaseous reactantsK_p = K_c(RT)^{\Delta n} \quad \text{where } \Delta n = \text{moles gaseous products} - \text{moles gaseous reactants}

ΔG=RTlnK=2.303RTlogK\Delta G^\circ = -RT\ln K = -2.303\,RT\log K

When K>1:ΔG<0 (product-favored);K<1:ΔG>0 (reactant-favored)\text{When } K > 1: \Delta G^\circ < 0 \text{ (product-favored)}; \quad K < 1: \Delta G^\circ > 0 \text{ (reactant-favored)}

pH and pOH

pH=log[H+]pOH=log[OH]pH+pOH=14 (at 25°C only)pH = -\log[H^+] \qquad pOH = -\log[OH^-] \qquad pH + pOH = 14 \text{ (at 25°C only)}

Kw=[H+][OH]=1014 at 25°CK_w = [H^+][OH^-] = 10^{-14} \text{ at 25°C}

Weak Acid / Base

Ka=Cα2Cα2 (when α1)[H+]=KaCK_a = C\alpha^2 \approx C\alpha^2 \text{ (when } \alpha \ll 1\text{)} \Rightarrow [H^+] = \sqrt{K_a \cdot C}

Ka×Kb=Kw=1014 (conjugate pair at 25°C)K_a \times K_b = K_w = 10^{-14} \text{ (conjugate pair at 25°C)}

Henderson-Hasselbalch

pH=pKa+log[A][HA]=pKa+log[salt][acid]pH = pK_a + \log\frac{[\text{A}^-]}{[\text{HA}]} = pK_a + \log\frac{[\text{salt}]}{[\text{acid}]}

pOH=pKb+log[BH+][B]=pKb+log[salt][base]pOH = pK_b + \log\frac{[\text{BH}^+]}{[\text{B}]} = pK_b + \log\frac{[\text{salt}]}{[\text{base}]}

Salt Hydrolysis

Weak acid + Strong base: pH=7+12pKa+12logC\text{Weak acid + Strong base: } pH = 7 + \tfrac{1}{2}pK_a + \tfrac{1}{2}\log C

Strong acid + Weak base: pH=712pKb12logC\text{Strong acid + Weak base: } pH = 7 - \tfrac{1}{2}pK_b - \tfrac{1}{2}\log C

Weak acid + Weak base: pH=7+12pKa12pKb\text{Weak acid + Weak base: } pH = 7 + \tfrac{1}{2}pK_a - \tfrac{1}{2}pK_b

Solubility Product

$$K_{sp} = [An+A^{n+}]^m[BmB^{m-}]^n \quad \text{for } A_mB_n \rightleftharpoons mAn+A^{n+} + n$B^{m-}$$$

AgCl: s=KspAg2CrO4:Ksp=4s3s=(Ksp4)1/3\text{AgCl: } s = \sqrt{K_{sp}} \qquad \text{Ag}_2\text{CrO}_4: K_{sp} = 4s^3 \Rightarrow s = \left(\frac{K_{sp}}{4}\right)^{1/3}

Key Reactions with Conditions

$N_{2}$(g) + $3H_{2}$(g) --[Fe catalyst, 400-500°C, 200 atm]--> $2NH_{3}$(g) (Haber process — exothermic; high T lowers yield)

AgCl(s) --[water]--> $Ag^{+}$(aq) + $Cl^{-}$(aq) ; Ksp = [Ag+Ag^{+}][ClCl^{-}] = 1.8×10101.8 \times 10^{-10}

Like these notes? Save your own copy and start studying with NoteTube's AI tools.

Sign up free to clone these notes